C19H17F5O2S — CID 10668922
(E)-3-ethoxy-4,4,5,5,5-pentafluoro-1-phenyl-2-phenylsulfanylpent-2-en-1-ol (PubChem CID 10668922) has the molecular formula C19H17F5O2S and a molecular weight of 404.40 g/mol. Its IUPAC name is (E)-3-ethoxy-4,4,5,5,5-pentafluoro-1-phenyl-2-phenylsulfanylpent-2-en-1-ol.
| Compound Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-1-phenyl-2-phenylsulfanylpent-2-en-1-ol |
|---|---|
| PubChem CID | 10668922 |
| Molecular Formula | C19H17F5O2S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-1-phenyl-2-phenylsulfanylpent-2-en-1-ol |
| SMILES | CCO/C(=C(/Sc1ccccc1)C(O)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H17F5O2S/c1-2-26-17(18(20,21)19(22,23)24)16(27-14-11-7-4-8-12-14)15(25)13-9-5-3-6-10-13/h3-12,15,25H,2H2,1H3/b17-16+ |
| InChIKey | WCUPSWMJZDLIIP-WUKNDPDISA-N |
| XLogP | 5.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|