C11H12F2OS — CID 102468057
(E)-1,1-difluoro-1-phenylsulfanylpent-3-en-2-ol (PubChem CID 102468057) has the molecular formula C11H12F2OS and a molecular weight of 230.28 g/mol. Its IUPAC name is (E)-1,1-difluoro-1-phenylsulfanylpent-3-en-2-ol.
| Compound Name | (E)-1,1-difluoro-1-phenylsulfanylpent-3-en-2-ol |
|---|---|
| PubChem CID | 102468057 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (E)-1,1-difluoro-1-phenylsulfanylpent-3-en-2-ol |
| SMILES | C/C=C/C(O)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C11H12F2OS/c1-2-6-10(14)11(12,13)15-9-7-4-3-5-8-9/h2-8,10,14H,1H3/b6-2+ |
| InChIKey | LZLLUVSKKYAJII-QHHAFSJGSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|