C19H24OS2 — CID 134881492
1,1-bis(phenylsulfanyl)heptan-2-ol (PubChem CID 134881492) has the molecular formula C19H24OS2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1,1-bis(phenylsulfanyl)heptan-2-ol.
| Compound Name | 1,1-bis(phenylsulfanyl)heptan-2-ol |
|---|---|
| PubChem CID | 134881492 |
| Molecular Formula | C19H24OS2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1,1-bis(phenylsulfanyl)heptan-2-ol |
| SMILES | CCCCCC(O)C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C19H24OS2/c1-2-3-6-15-18(20)19(21-16-11-7-4-8-12-16)22-17-13-9-5-10-14-17/h4-5,7-14,18-20H,2-3,6,15H2,1H3 |
| InChIKey | HKJDOXLKAYVPSP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|