C23H34OSSi — CID 134929228
tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane (PubChem CID 134929228) has the molecular formula C23H34OSSi and a molecular weight of 386.68 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134929228 |
| Molecular Formula | C23H34OSSi |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane |
| SMILES | CCS[C@H](c1ccc(C)cc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H34OSSi/c1-8-25-22(20-16-14-18(2)15-17-20)21(19-12-10-9-11-13-19)24-26(6,7)23(3,4)5/h9-17,21-22H,8H2,1-7H3/t21-,22-/m1/s1 |
| InChIKey | UPKKESOMYUDTOL-FGZHOGPDSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|