About triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane
triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane (PubChem CID 102515903) has the molecular formula C22H30OSi
and a molecular weight of 338.57 g/mol. Its IUPAC name is triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane.
Molecular Properties
| Compound Name | triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane |
| PubChem CID | 102515903 |
| Molecular Formula | C22H30OSi |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@H](/C(C)=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30OSi/c1-5-24(6-2,7-3)23-22(21-16-12-9-13-17-21)19(4)18-20-14-10-8-11-15-20/h8-18,22H,5-7H2,1-4H3/b19-18+/t22-/m1/s1 |
| InChIKey | UIWRLQNRENUXSF-ZSVKVYQISA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane?
The IUPAC name of triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane (CID 102515903) is triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane.
What is the SMILES notation for triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane?
The canonical SMILES for triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane is CC[Si](CC)(CC)O[C@H](/C(C)=C/c1ccccc1)c1ccccc1.
What is the InChIKey of triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane?
The InChIKey is UIWRLQNRENUXSF-ZSVKVYQISA-N. The full InChI is InChI=1S/C22H30OSi/c1-5-24(6-2,7-3)23-22(21-16-12-9-13-17-21)19(4)18-20-14-10-8-11-15-20/h8-18,22H,5-7H2,1-4H3/b19-18+/t22-/m1/s1.
What are the key properties of triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane?
triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane has a molecular weight of 338.57 g/mol, XLogP of 6.85, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane is sourced from PubChem (CID 102515903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).