C22H30OSi — CID 102515903
triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane (PubChem CID 102515903) has the molecular formula C22H30OSi and a molecular weight of 338.57 g/mol. Its IUPAC name is triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane.
| Compound Name | triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane |
|---|---|
| PubChem CID | 102515903 |
| Molecular Formula | C22H30OSi |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | triethyl-[(E,1R)-2-methyl-1,3-diphenylprop-2-enoxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@H](/C(C)=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30OSi/c1-5-24(6-2,7-3)23-22(21-16-12-9-13-17-21)19(4)18-20-14-10-8-11-15-20/h8-18,22H,5-7H2,1-4H3/b19-18+/t22-/m1/s1 |
| InChIKey | UIWRLQNRENUXSF-ZSVKVYQISA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|