C19H24OS — CID 15257346
(1R,2S)-2-tert-butylsulfanyl-1,3-diphenylpropan-1-ol (PubChem CID 15257346) has the molecular formula C19H24OS and a molecular weight of 300.47 g/mol. Its IUPAC name is (1R,2S)-2-tert-butylsulfanyl-1,3-diphenylpropan-1-ol.
| Compound Name | (1R,2S)-2-tert-butylsulfanyl-1,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 15257346 |
| Molecular Formula | C19H24OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1R,2S)-2-tert-butylsulfanyl-1,3-diphenylpropan-1-ol |
| SMILES | CC(C)(C)S[C@@H](Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H24OS/c1-19(2,3)21-17(14-15-10-6-4-7-11-15)18(20)16-12-8-5-9-13-16/h4-13,17-18,20H,14H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | MXONWOFFCMFYEF-ZWKOTPCHSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |