C26H37F3OSi2 — CID 154720026
dimethyl-phenyl-[(Z)-5-triethylsilyloxy-5-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane (PubChem CID 154720026) has the molecular formula C26H37F3OSi2 and a molecular weight of 478.75 g/mol. Its IUPAC name is dimethyl-phenyl-[(Z)-5-triethylsilyloxy-5-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane.
| Compound Name | dimethyl-phenyl-[(Z)-5-triethylsilyloxy-5-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane |
|---|---|
| PubChem CID | 154720026 |
| Molecular Formula | C26H37F3OSi2 |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | dimethyl-phenyl-[(Z)-5-triethylsilyloxy-5-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane |
| SMILES | CC[Si](CC)(CC)OC(C/C=C\C[Si](C)(C)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H37F3OSi2/c1-6-32(7-2,8-3)30-25(22-17-19-23(20-18-22)26(27,28)29)16-12-13-21-31(4,5)24-14-10-9-11-15-24/h9-15,17-20,25H,6-8,16,21H2,1-5H3/b13-12- |
| InChIKey | FIGOBXRGETZGBO-SEYXRHQNSA-N |
| XLogP | 8.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|