C22H32OSSi — CID 135050526
trimethyl-[(2R)-2-[(S)-phenyl(phenylsulfanyl)methyl]hexoxy]silane (PubChem CID 135050526) has the molecular formula C22H32OSSi and a molecular weight of 372.65 g/mol. Its IUPAC name is trimethyl-[(2R)-2-[(S)-phenyl(phenylsulfanyl)methyl]hexoxy]silane.
| Compound Name | trimethyl-[(2R)-2-[(S)-phenyl(phenylsulfanyl)methyl]hexoxy]silane |
|---|---|
| PubChem CID | 135050526 |
| Molecular Formula | C22H32OSSi |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | trimethyl-[(2R)-2-[(S)-phenyl(phenylsulfanyl)methyl]hexoxy]silane |
| SMILES | CCCC[C@H](CO[Si](C)(C)C)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32OSSi/c1-5-6-13-20(18-23-25(2,3)4)22(19-14-9-7-10-15-19)24-21-16-11-8-12-17-21/h7-12,14-17,20,22H,5-6,13,18H2,1-4H3/t20-,22-/m1/s1 |
| InChIKey | CROOLAJBJPDCPK-IFMALSPDSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|