C27H48O2SSi2 — CID 14961477
trimethyl-[[3-methyl-2-phenylsulfanyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methoxy]silane (PubChem CID 14961477) has the molecular formula C27H48O2SSi2 and a molecular weight of 492.92 g/mol. Its IUPAC name is trimethyl-[[3-methyl-2-phenylsulfanyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methoxy]silane.
| Compound Name | trimethyl-[[3-methyl-2-phenylsulfanyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 14961477 |
| Molecular Formula | C27H48O2SSi2 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | trimethyl-[[3-methyl-2-phenylsulfanyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methoxy]silane |
| SMILES | CC1=CCCC(CO[Si](C)(C)C)(CO[Si](C(C)C)(C(C)C)C(C)C)C1Sc1ccccc1 |
| InChI | InChI=1S/C27H48O2SSi2/c1-21(2)32(22(3)4,23(5)6)29-20-27(19-28-31(8,9)10)18-14-15-24(7)26(27)30-25-16-12-11-13-17-25/h11-13,15-17,21-23,26H,14,18-20H2,1-10H3 |
| InChIKey | HJVLSPNRXHZVKA-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|