C22H32OSSi — CID 135030321
tert-butyl-dimethyl-(4-phenyl-4-phenylsulfanylbutoxy)silane (PubChem CID 135030321) has the molecular formula C22H32OSSi and a molecular weight of 372.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-(4-phenyl-4-phenylsulfanylbutoxy)silane.
| Compound Name | tert-butyl-dimethyl-(4-phenyl-4-phenylsulfanylbutoxy)silane |
|---|---|
| PubChem CID | 135030321 |
| Molecular Formula | C22H32OSSi |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | tert-butyl-dimethyl-(4-phenyl-4-phenylsulfanylbutoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32OSSi/c1-22(2,3)25(4,5)23-18-12-17-21(19-13-8-6-9-14-19)24-20-15-10-7-11-16-20/h6-11,13-16,21H,12,17-18H2,1-5H3 |
| InChIKey | FYAOZSPSYZQKFP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|