C31H40OSSi — CID 91510143
tert-butyl-[4-(2-cyclopentylsulfanylphenyl)butoxy]-diphenylsilane (PubChem CID 91510143) has the molecular formula C31H40OSSi and a molecular weight of 488.81 g/mol. Its IUPAC name is tert-butyl-[4-(2-cyclopentylsulfanylphenyl)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(2-cyclopentylsulfanylphenyl)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 91510143 |
| Molecular Formula | C31H40OSSi |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl-[4-(2-cyclopentylsulfanylphenyl)butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCc1ccccc1SC1CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40OSSi/c1-31(2,3)34(28-20-6-4-7-21-28,29-22-8-5-9-23-29)32-25-15-14-17-26-16-10-13-24-30(26)33-27-18-11-12-19-27/h4-10,13,16,20-24,27H,11-12,14-15,17-19,25H2,1-3H3 |
| InChIKey | CDEGSQOENBCHDK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|