C36H52O3S — CID 134887181
[(1E,3E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene (PubChem CID 134887181) has the molecular formula C36H52O3S and a molecular weight of 564.88 g/mol. Its IUPAC name is [(1E,3E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene.
| Compound Name | [(1E,3E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 134887181 |
| Molecular Formula | C36H52O3S |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | [(1E,3E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/COC/C=C(\C)CC(/C=C(C)/C=C/C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H52O3S/c1-28(2)14-12-15-29(3)21-24-39-25-22-31(5)27-34(40(37,38)33-17-10-9-11-18-33)26-30(4)19-20-35-32(6)16-13-23-36(35,7)8/h9-11,14,17-22,26,34H,12-13,15-16,23-25,27H2,1-8H3/b20-19+,29-21+,30-26+,31-22+ |
| InChIKey | AZWALOGRMXNMRK-HTYWWQSJSA-N |
| XLogP | 9.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|