C23H32O3S2Si — CID 139253748
3,3-bis[(S)-(4-methylphenyl)sulfinyl]prop-2-enoxy-tert-butyl-dimethylsilane (PubChem CID 139253748) has the molecular formula C23H32O3S2Si and a molecular weight of 448.73 g/mol. Its IUPAC name is 3,3-bis[(S)-(4-methylphenyl)sulfinyl]prop-2-enoxy-tert-butyl-dimethylsilane.
| Compound Name | 3,3-bis[(S)-(4-methylphenyl)sulfinyl]prop-2-enoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139253748 |
| Molecular Formula | C23H32O3S2Si |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3,3-bis[(S)-(4-methylphenyl)sulfinyl]prop-2-enoxy-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc([S@](=O)C(=CCO[Si](C)(C)C(C)(C)C)[S@@](=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H32O3S2Si/c1-18-8-12-20(13-9-18)27(24)22(16-17-26-29(6,7)23(3,4)5)28(25)21-14-10-19(2)11-15-21/h8-16H,17H2,1-7H3/t27-,28-/m0/s1 |
| InChIKey | MSYGZPHSLDCMDZ-NSOVKSMOSA-N |
| XLogP | 6.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|