C30H45NO2SSi — CID 138970060
[(Z,1S,2R)-1-cyclohexyl-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-phenylbut-3-enoxy]-triethylsilane (PubChem CID 138970060) has the molecular formula C30H45NO2SSi and a molecular weight of 511.85 g/mol. Its IUPAC name is [(Z,1S,2R)-1-cyclohexyl-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-phenylbut-3-enoxy]-triethylsilane.
| Compound Name | [(Z,1S,2R)-1-cyclohexyl-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-phenylbut-3-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 138970060 |
| Molecular Formula | C30H45NO2SSi |
| Molecular Weight | 511.85 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | [(Z,1S,2R)-1-cyclohexyl-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-phenylbut-3-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C1CCCCC1)[C@@H](/C(C)=C\[S@@](=O)(=NC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H45NO2SSi/c1-6-35(7-2,8-3)33-30(27-20-14-10-15-21-27)29(26-18-12-9-13-19-26)25(4)24-34(32,31-5)28-22-16-11-17-23-28/h9,11-13,16-19,22-24,27,29-30H,6-8,10,14-15,20-21H2,1-5H3/b25-24-/t29-,30-,34-/m0/s1 |
| InChIKey | XDZPMFWSVBRYCM-SMUAOITRSA-N |
| XLogP | 8.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.85 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|