C21H37NO2SSi — CID 138970930
triethyl-[(Z,2S,3R)-5-(N-methyl-S-phenylsulfonimidoyl)-3-propan-2-ylpent-4-en-2-yl]oxysilane (PubChem CID 138970930) has the molecular formula C21H37NO2SSi and a molecular weight of 395.69 g/mol. Its IUPAC name is triethyl-[(Z,2S,3R)-5-(N-methyl-S-phenylsulfonimidoyl)-3-propan-2-ylpent-4-en-2-yl]oxysilane.
| Compound Name | triethyl-[(Z,2S,3R)-5-(N-methyl-S-phenylsulfonimidoyl)-3-propan-2-ylpent-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 138970930 |
| Molecular Formula | C21H37NO2SSi |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | triethyl-[(Z,2S,3R)-5-(N-methyl-S-phenylsulfonimidoyl)-3-propan-2-ylpent-4-en-2-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)[C@@H](/C=C\[S@@](=O)(=NC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C21H37NO2SSi/c1-8-26(9-2,10-3)24-19(6)21(18(4)5)16-17-25(23,22-7)20-14-12-11-13-15-20/h11-19,21H,8-10H2,1-7H3/b17-16-/t19-,21-,25-/m0/s1 |
| InChIKey | SCXJCQUFEYPABX-NGSJENRXSA-N |
| XLogP | 6.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|