C29H49NO3SSi — CID 175668185
(7E,9R,10S)-11-methyl-7-(N-methyl-S-phenylsulfonimidoyl)-9-propan-2-yl-10-triethylsilyloxydodeca-1,7-dien-6-one (PubChem CID 175668185) has the molecular formula C29H49NO3SSi and a molecular weight of 519.87 g/mol. Its IUPAC name is (7E,9R,10S)-11-methyl-7-(N-methyl-S-phenylsulfonimidoyl)-9-propan-2-yl-10-triethylsilyloxydodeca-1,7-dien-6-one.
| Compound Name | (7E,9R,10S)-11-methyl-7-(N-methyl-S-phenylsulfonimidoyl)-9-propan-2-yl-10-triethylsilyloxydodeca-1,7-dien-6-one |
|---|---|
| PubChem CID | 175668185 |
| Molecular Formula | C29H49NO3SSi |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | (7E,9R,10S)-11-methyl-7-(N-methyl-S-phenylsulfonimidoyl)-9-propan-2-yl-10-triethylsilyloxydodeca-1,7-dien-6-one |
| SMILES | C=CCCCC(=O)/C(=C\[C@@H](C(C)C)[C@@H](O[Si](CC)(CC)CC)C(C)C)[S@@](=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C29H49NO3SSi/c1-10-14-16-21-27(31)28(34(32,30-9)25-19-17-15-18-20-25)22-26(23(5)6)29(24(7)8)33-35(11-2,12-3)13-4/h10,15,17-20,22-24,26,29H,1,11-14,16,21H2,2-9H3/b28-22+/t26-,29-,34+/m0/s1 |
| InChIKey | WNQWHLVCNJHDIO-GKKGRKGDSA-N |
| XLogP | 8.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|