C24H40O2SSi — CID 10938713
(Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-4-phenylsulfanylnon-4-en-3-one (PubChem CID 10938713) has the molecular formula C24H40O2SSi and a molecular weight of 420.74 g/mol. Its IUPAC name is (Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-4-phenylsulfanylnon-4-en-3-one.
| Compound Name | (Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-4-phenylsulfanylnon-4-en-3-one |
|---|---|
| PubChem CID | 10938713 |
| Molecular Formula | C24H40O2SSi |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (Z,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-4-phenylsulfanylnon-4-en-3-one |
| SMILES | CC(C)C(=O)/C(=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C24H40O2SSi/c1-17(2)22(25)21(27-20-14-12-11-13-15-20)16-19(5)23(18(3)4)26-28(9,10)24(6,7)8/h11-19,23H,1-10H3/b21-16-/t19-,23+/m0/s1 |
| InChIKey | QRCDOEKCFJJJLI-JSRQMMCBSA-N |
| XLogP | 7.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|