C26H42OSSi — CID 11091298
tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenylsulfanyldodec-5-en-7-yn-3-yl]oxy-dimethylsilane (PubChem CID 11091298) has the molecular formula C26H42OSSi and a molecular weight of 430.77 g/mol. Its IUPAC name is tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenylsulfanyldodec-5-en-7-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenylsulfanyldodec-5-en-7-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11091298 |
| Molecular Formula | C26H42OSSi |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | tert-butyl-[(Z,3R,4S)-2,4-dimethyl-6-phenylsulfanyldodec-5-en-7-yn-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC#C/C(=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C26H42OSSi/c1-10-11-12-14-19-24(28-23-17-15-13-16-18-23)20-22(4)25(21(2)3)27-29(8,9)26(5,6)7/h13,15-18,20-22,25H,10-12H2,1-9H3/b24-20-/t22-,25+/m0/s1 |
| InChIKey | ZNEWENSGQPLBOI-RPMBAIPLSA-N |
| XLogP | 8.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|