C16H26OSSi — CID 10990080
tert-butyl-dimethyl-[(Z,2R)-4-phenylsulfanylbut-3-en-2-yl]oxysilane (PubChem CID 10990080) has the molecular formula C16H26OSSi and a molecular weight of 294.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2R)-4-phenylsulfanylbut-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,2R)-4-phenylsulfanylbut-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 10990080 |
| Molecular Formula | C16H26OSSi |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2R)-4-phenylsulfanylbut-3-en-2-yl]oxysilane |
| SMILES | C[C@H](/C=C\Sc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26OSSi/c1-14(17-19(5,6)16(2,3)4)12-13-18-15-10-8-7-9-11-15/h7-14H,1-6H3/b13-12-/t14-/m1/s1 |
| InChIKey | DRISQLQHUQOTNZ-WUFNSSIPSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|