C20H33BrOSSiZn — CID 135076477
bromozinc(1+);tert-butyl-[(3R,4S)-2,4-dimethyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 135076477) has the molecular formula C20H33BrOSSiZn and a molecular weight of 494.93 g/mol. Its IUPAC name is bromozinc(1+);tert-butyl-[(3R,4S)-2,4-dimethyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | bromozinc(1+);tert-butyl-[(3R,4S)-2,4-dimethyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135076477 |
| Molecular Formula | C20H33BrOSSiZn |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | bromozinc(1+);tert-butyl-[(3R,4S)-2,4-dimethyl-6-phenylsulfanylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=[C-]/Sc1ccccc1.[Zn+]Br |
| InChI | InChI=1S/C20H33OSSi.BrH.Zn/c1-16(2)19(21-23(7,8)20(4,5)6)17(3)14-15-22-18-12-10-9-11-13-18;;/h9-14,16-17,19H,1-8H3;1H;/q-1;;+2/p-1/t17-,19+;;/m0../s1 |
| InChIKey | QXLAQPWFDSPIPX-UKWJXJBFSA-M |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|