C26H40O2SSi — CID 15040854
2-[(Z,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-phenylsulfanylhex-1-enyl]cyclohex-2-en-1-one (PubChem CID 15040854) has the molecular formula C26H40O2SSi and a molecular weight of 444.76 g/mol. Its IUPAC name is 2-[(Z,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-phenylsulfanylhex-1-enyl]cyclohex-2-en-1-one.
| Compound Name | 2-[(Z,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-phenylsulfanylhex-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 15040854 |
| Molecular Formula | C26H40O2SSi |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[(Z,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-phenylsulfanylhex-1-enyl]cyclohex-2-en-1-one |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\Sc1ccccc1)C1=CCCCC1=O |
| InChI | InChI=1S/C26H40O2SSi/c1-19(2)25(28-30(7,8)26(4,5)6)20(3)18-24(22-16-12-13-17-23(22)27)29-21-14-10-9-11-15-21/h9-11,14-16,18-20,25H,12-13,17H2,1-8H3/b24-18-/t20-,25+/m0/s1 |
| InChIKey | NCLJXUPQFKJTEY-FAZUUGCBSA-N |
| XLogP | 8.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|