C32H52O3SSi2 — CID 139654222
7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enylidene]-2-phenylsulfanylcyclohept-2-en-1-one (PubChem CID 139654222) has the molecular formula C32H52O3SSi2 and a molecular weight of 573.00 g/mol. Its IUPAC name is 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enylidene]-2-phenylsulfanylcyclohept-2-en-1-one.
| Compound Name | 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enylidene]-2-phenylsulfanylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 139654222 |
| Molecular Formula | C32H52O3SSi2 |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enylidene]-2-phenylsulfanylcyclohept-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(C=CC=C1CCCC=C(Sc2ccccc2)C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52O3SSi2/c1-31(2,3)37(7,8)34-25-17-21-27(35-38(9,10)32(4,5)6)20-16-19-26-18-14-15-24-29(30(26)33)36-28-22-12-11-13-23-28/h11-13,16,19-20,22-24,27H,14-15,17-18,21,25H2,1-10H3 |
| InChIKey | MROTUIQDMLFQKB-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|