C32H54O4SSi2 — CID 139654192
7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxyhept-2-enyl]-2-phenylsulfanylcyclohept-2-en-1-one (PubChem CID 139654192) has the molecular formula C32H54O4SSi2 and a molecular weight of 591.02 g/mol. Its IUPAC name is 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxyhept-2-enyl]-2-phenylsulfanylcyclohept-2-en-1-one.
| Compound Name | 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxyhept-2-enyl]-2-phenylsulfanylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 139654192 |
| Molecular Formula | C32H54O4SSi2 |
| Molecular Weight | 591.02 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 7-[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxyhept-2-enyl]-2-phenylsulfanylcyclohept-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(C=CC(O)C1CCCC=C(Sc2ccccc2)C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O4SSi2/c1-31(2,3)38(7,8)35-24-16-17-25(36-39(9,10)32(4,5)6)22-23-28(33)27-20-14-15-21-29(30(27)34)37-26-18-12-11-13-19-26/h11-13,18-19,21-23,25,27-28,33H,14-17,20,24H2,1-10H3 |
| InChIKey | HLLNQPVXHJWJDP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.02 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|