C33H46O5SSi — CID 172793179
methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-phenylsulfanylcyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate (PubChem CID 172793179) has the molecular formula C33H46O5SSi and a molecular weight of 582.88 g/mol. Its IUPAC name is methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-phenylsulfanylcyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-phenylsulfanylcyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 172793179 |
| Molecular Formula | C33H46O5SSi |
| Molecular Weight | 582.88 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-phenylsulfanylcyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
| SMILES | COC(=O)CCCC#CC(O)C1C(=O)C(Sc2ccccc2)=CC1C=CC(O[Si](C)(C)C(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C33H46O5SSi/c1-33(2,3)40(5,6)38-28(24-15-13-14-16-24)22-21-25-23-29(39-26-17-9-7-10-18-26)32(36)31(25)27(34)19-11-8-12-20-30(35)37-4/h7,9-10,17-18,21-25,27-28,31,34H,8,12-16,20H2,1-6H3 |
| InChIKey | PVSIZXXVYIOCKQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.88 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|