C36H50O4SSi — CID 54274035
methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-ylidene]hept-5-ynoate (PubChem CID 54274035) has the molecular formula C36H50O4SSi and a molecular weight of 606.95 g/mol. Its IUPAC name is methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-ylidene]hept-5-ynoate.
| Compound Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-ylidene]hept-5-ynoate |
|---|---|
| PubChem CID | 54274035 |
| Molecular Formula | C36H50O4SSi |
| Molecular Weight | 606.95 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylprop-1-enyl]-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-ylidene]hept-5-ynoate |
| SMILES | COC(=O)CCCC#CC=C1C(=O)C(SCCCc2ccccc2)=CC1C=CC(O[Si](C)(C)C(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C36H50O4SSi/c1-36(2,3)42(5,6)40-32(29-20-14-15-21-29)25-24-30-27-33(41-26-16-19-28-17-10-9-11-18-28)35(38)31(30)22-12-7-8-13-23-34(37)39-4/h9-11,17-18,22,24-25,27,29-30,32H,8,13-16,19-21,23,26H2,1-6H3 |
| InChIKey | RMDNHKUIPLUZNA-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.95 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|