C42H74O4SSi2 — CID 57071381
methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 57071381) has the molecular formula C42H74O4SSi2 and a molecular weight of 731.29 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 57071381 |
| Molecular Formula | C42H74O4SSi2 |
| Molecular Weight | 731.29 g/mol |
| Exact Mass | 730.48 |
| IUPAC Name | methyl 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCCC(C)CC(C=C[C@@H]1C(SCCCCCC(=O)OC)=C(CCc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H74O4SSi2/c1-14-15-22-33(2)31-36(45-48(10,11)41(3,4)5)28-29-37-38(46-49(12,13)42(6,7)8)32-35(27-26-34-23-18-16-19-24-34)40(37)47-30-21-17-20-25-39(43)44-9/h16,18-19,23-24,28-29,33,36-38H,14-15,17,20-22,25-27,30-32H2,1-13H3/t33?,36?,37-,38+/m0/s1 |
| InChIKey | QGBRBHBVBJJGQD-WEEVLFOQSA-N |
| XLogP | 12.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.29 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|