C25H42O4SSi — CID 10950727
[(2R,3S)-1-benzylsulfanyl-2-methyl-1-oxopentan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate (PubChem CID 10950727) has the molecular formula C25H42O4SSi and a molecular weight of 466.76 g/mol. Its IUPAC name is [(2R,3S)-1-benzylsulfanyl-2-methyl-1-oxopentan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate.
| Compound Name | [(2R,3S)-1-benzylsulfanyl-2-methyl-1-oxopentan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate |
|---|---|
| PubChem CID | 10950727 |
| Molecular Formula | C25H42O4SSi |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [(2R,3S)-1-benzylsulfanyl-2-methyl-1-oxopentan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)O[C@@H](CC)[C@@H](C)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C25H42O4SSi/c1-10-21(19(4)24(27)30-17-20-15-13-12-14-16-20)28-23(26)18(3)22(11-2)29-31(8,9)25(5,6)7/h12-16,18-19,21-22H,10-11,17H2,1-9H3/t18-,19+,21-,22-/m0/s1 |
| InChIKey | MNQUGIHKJPYDFH-MXNKGDRCSA-N |
| XLogP | 6.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|