C22H30O4SSi — CID 164679266
diethyl 2-methyl-2-[(5Z)-4-phenyl-5-(trimethylsilylmethylidene)-2H-thiophen-2-yl]propanedioate (PubChem CID 164679266) has the molecular formula C22H30O4SSi and a molecular weight of 418.63 g/mol. Its IUPAC name is diethyl 2-methyl-2-[(5Z)-4-phenyl-5-(trimethylsilylmethylidene)-2H-thiophen-2-yl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[(5Z)-4-phenyl-5-(trimethylsilylmethylidene)-2H-thiophen-2-yl]propanedioate |
|---|---|
| PubChem CID | 164679266 |
| Molecular Formula | C22H30O4SSi |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | diethyl 2-methyl-2-[(5Z)-4-phenyl-5-(trimethylsilylmethylidene)-2H-thiophen-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C1C=C(c2ccccc2)/C(=C/[Si](C)(C)C)S1 |
| InChI | InChI=1S/C22H30O4SSi/c1-7-25-20(23)22(3,21(24)26-8-2)19-14-17(16-12-10-9-11-13-16)18(27-19)15-28(4,5)6/h9-15,19H,7-8H2,1-6H3/b18-15- |
| InChIKey | PTRSEEDTBJBKTL-SDXDJHTJSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|