C19H30O4SSi — CID 11516497
methyl (3S)-5-benzylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate (PubChem CID 11516497) has the molecular formula C19H30O4SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is methyl (3S)-5-benzylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate.
| Compound Name | methyl (3S)-5-benzylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 11516497 |
| Molecular Formula | C19H30O4SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl (3S)-5-benzylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
| SMILES | COC(=O)C[C@@H](CC(=O)SCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O4SSi/c1-19(2,3)25(5,6)23-16(12-17(20)22-4)13-18(21)24-14-15-10-8-7-9-11-15/h7-11,16H,12-14H2,1-6H3/t16-/m0/s1 |
| InChIKey | GEVXMEWQNGGNBJ-INIZCTEOSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|