C23H34O6S — CID 20600529
(1-benzylsulfanyl-5-oxohexan-3-yl) 3-(3-methoxybutanoyloxy)pentanoate (PubChem CID 20600529) has the molecular formula C23H34O6S and a molecular weight of 438.59 g/mol. Its IUPAC name is (1-benzylsulfanyl-5-oxohexan-3-yl) 3-(3-methoxybutanoyloxy)pentanoate.
| Compound Name | (1-benzylsulfanyl-5-oxohexan-3-yl) 3-(3-methoxybutanoyloxy)pentanoate |
|---|---|
| PubChem CID | 20600529 |
| Molecular Formula | C23H34O6S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1-benzylsulfanyl-5-oxohexan-3-yl) 3-(3-methoxybutanoyloxy)pentanoate |
| SMILES | CCC(CC(=O)OC(CCSCc1ccccc1)CC(C)=O)OC(=O)CC(C)OC |
| InChI | InChI=1S/C23H34O6S/c1-5-20(28-22(25)14-18(3)27-4)15-23(26)29-21(13-17(2)24)11-12-30-16-19-9-7-6-8-10-19/h6-10,18,20-21H,5,11-16H2,1-4H3 |
| InChIKey | SLQQENSLUNFXDP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|