C15H18O4S — CID 14176850
ethyl 1-benzyl-1,5-dioxo-3,4-dihydro-2H-thiopyran-6-carboxylate (PubChem CID 14176850) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is ethyl 1-benzyl-1,5-dioxo-3,4-dihydro-2H-thiopyran-6-carboxylate.
| Compound Name | ethyl 1-benzyl-1,5-dioxo-3,4-dihydro-2H-thiopyran-6-carboxylate |
|---|---|
| PubChem CID | 14176850 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | ethyl 1-benzyl-1,5-dioxo-3,4-dihydro-2H-thiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1=S(=O)(Cc2ccccc2)CCCC1=O |
| InChI | InChI=1S/C15H18O4S/c1-2-19-15(17)14-13(16)9-6-10-20(14,18)11-12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3 |
| InChIKey | DMSBAXZHDDDEHN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|