C17H20O4S — CID 14176852
ethyl 1,5-dioxo-1-[(E)-3-phenylprop-2-enyl]-3,4-dihydro-2H-thiopyran-6-carboxylate (PubChem CID 14176852) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 1,5-dioxo-1-[(E)-3-phenylprop-2-enyl]-3,4-dihydro-2H-thiopyran-6-carboxylate.
| Compound Name | ethyl 1,5-dioxo-1-[(E)-3-phenylprop-2-enyl]-3,4-dihydro-2H-thiopyran-6-carboxylate |
|---|---|
| PubChem CID | 14176852 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | ethyl 1,5-dioxo-1-[(E)-3-phenylprop-2-enyl]-3,4-dihydro-2H-thiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1=S(=O)(C/C=C/c2ccccc2)CCCC1=O |
| InChI | InChI=1S/C17H20O4S/c1-2-21-17(19)16-15(18)11-7-13-22(16,20)12-6-10-14-8-4-3-5-9-14/h3-6,8-10H,2,7,11-13H2,1H3/b10-6+ |
| InChIKey | XCQQOHPBRIUPNY-UXBLZVDNSA-N |
| XLogP | 2.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|