C34H50O8S — CID 59067566
2-oxodec-6-en-4-yl 3-[3-(5-benzylsulfanyl-3-methoxypentanoyl)oxybutanoyloxy]hept-5-enoate (PubChem CID 59067566) has the molecular formula C34H50O8S and a molecular weight of 618.83 g/mol. Its IUPAC name is 2-oxodec-6-en-4-yl 3-[3-(5-benzylsulfanyl-3-methoxypentanoyl)oxybutanoyloxy]hept-5-enoate.
| Compound Name | 2-oxodec-6-en-4-yl 3-[3-(5-benzylsulfanyl-3-methoxypentanoyl)oxybutanoyloxy]hept-5-enoate |
|---|---|
| PubChem CID | 59067566 |
| Molecular Formula | C34H50O8S |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 2-oxodec-6-en-4-yl 3-[3-(5-benzylsulfanyl-3-methoxypentanoyl)oxybutanoyloxy]hept-5-enoate |
| SMILES | CC=CCC(CC(=O)OC(CC=CCCC)CC(C)=O)OC(=O)CC(C)OC(=O)CC(CCSCc1ccccc1)OC |
| InChI | InChI=1S/C34H50O8S/c1-6-8-10-14-18-30(21-26(3)35)41-34(38)24-31(17-9-7-2)42-32(36)22-27(4)40-33(37)23-29(39-5)19-20-43-25-28-15-12-11-13-16-28/h7,9-16,27,29-31H,6,8,17-25H2,1-5H3 |
| InChIKey | CDHUPPGOWNUYND-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|