C36H53NO9 — CID 58785831
2-oxotridec-6-en-4-yl 3-[3-[4-(4-cyanophenoxy)-3-methoxybutanoyl]oxybutanoyloxy]heptanoate (PubChem CID 58785831) has the molecular formula C36H53NO9 and a molecular weight of 643.82 g/mol. Its IUPAC name is 2-oxotridec-6-en-4-yl 3-[3-[4-(4-cyanophenoxy)-3-methoxybutanoyl]oxybutanoyloxy]heptanoate.
| Compound Name | 2-oxotridec-6-en-4-yl 3-[3-[4-(4-cyanophenoxy)-3-methoxybutanoyl]oxybutanoyloxy]heptanoate |
|---|---|
| PubChem CID | 58785831 |
| Molecular Formula | C36H53NO9 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.37 |
| IUPAC Name | 2-oxotridec-6-en-4-yl 3-[3-[4-(4-cyanophenoxy)-3-methoxybutanoyl]oxybutanoyloxy]heptanoate |
| SMILES | CCCCCCC=CCC(CC(C)=O)OC(=O)CC(CCCC)OC(=O)CC(C)OC(=O)CC(COc1ccc(C#N)cc1)OC |
| InChI | InChI=1S/C36H53NO9/c1-6-8-10-11-12-13-14-16-31(21-27(3)38)45-36(41)23-32(15-9-7-2)46-34(39)22-28(4)44-35(40)24-33(42-5)26-43-30-19-17-29(25-37)18-20-30/h13-14,17-20,28,31-33H,6-12,15-16,21-24,26H2,1-5H3 |
| InChIKey | XCHRRYOZVDPMJS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|