C23H38O7SSi — CID 59305888
diethyl 2-[phenyl(3-triethoxysilylpropylsulfanyl)methyl]propanedioate (PubChem CID 59305888) has the molecular formula C23H38O7SSi and a molecular weight of 486.70 g/mol. Its IUPAC name is diethyl 2-[phenyl(3-triethoxysilylpropylsulfanyl)methyl]propanedioate.
| Compound Name | diethyl 2-[phenyl(3-triethoxysilylpropylsulfanyl)methyl]propanedioate |
|---|---|
| PubChem CID | 59305888 |
| Molecular Formula | C23H38O7SSi |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | diethyl 2-[phenyl(3-triethoxysilylpropylsulfanyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(SCCC[Si](OCC)(OCC)OCC)c1ccccc1 |
| InChI | InChI=1S/C23H38O7SSi/c1-6-26-22(24)20(23(25)27-7-2)21(19-15-12-11-13-16-19)31-17-14-18-32(28-8-3,29-9-4)30-10-5/h11-13,15-16,20-21H,6-10,14,17-18H2,1-5H3 |
| InChIKey | FJBWBTDSQXUFOC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|