C26H38O6SSi — CID 59536968
(4-methoxyphenyl)methyl 3-phenyl-3-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59536968) has the molecular formula C26H38O6SSi and a molecular weight of 506.74 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-phenyl-3-(3-triethoxysilylpropylsulfanyl)propanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-phenyl-3-(3-triethoxysilylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59536968 |
| Molecular Formula | C26H38O6SSi |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-phenyl-3-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSC(CC(=O)OCc1ccc(OC)cc1)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C26H38O6SSi/c1-5-30-34(31-6-2,32-7-3)19-11-18-33-25(23-12-9-8-10-13-23)20-26(27)29-21-22-14-16-24(28-4)17-15-22/h8-10,12-17,25H,5-7,11,18-21H2,1-4H3 |
| InChIKey | GZTQHIPZYIDBQI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|