C22H29NO7S — CID 88777989
diethyl 2-[[3-oxo-3-[(2S)-pyrrolidine-2-carbonyl]oxypropyl]sulfanyl-phenylmethyl]propanedioate (PubChem CID 88777989) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is diethyl 2-[[3-oxo-3-[(2S)-pyrrolidine-2-carbonyl]oxypropyl]sulfanyl-phenylmethyl]propanedioate.
| Compound Name | diethyl 2-[[3-oxo-3-[(2S)-pyrrolidine-2-carbonyl]oxypropyl]sulfanyl-phenylmethyl]propanedioate |
|---|---|
| PubChem CID | 88777989 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | diethyl 2-[[3-oxo-3-[(2S)-pyrrolidine-2-carbonyl]oxypropyl]sulfanyl-phenylmethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(SCCC(=O)OC(=O)[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO7S/c1-3-28-21(26)18(22(27)29-4-2)19(15-9-6-5-7-10-15)31-14-12-17(24)30-20(25)16-11-8-13-23-16/h5-7,9-10,16,18-19,23H,3-4,8,11-14H2,1-2H3/t16-,19?/m0/s1 |
| InChIKey | WYURLFCLHBGNLL-UCFFOFKASA-N |
| XLogP | 2.42 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|