C23H23NO5S — CID 88734281
(3-acetylsulfanyl-4-oxo-2,4-diphenylbutanoyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 88734281) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is (3-acetylsulfanyl-4-oxo-2,4-diphenylbutanoyl) (2S)-pyrrolidine-2-carboxylate.
| Compound Name | (3-acetylsulfanyl-4-oxo-2,4-diphenylbutanoyl) (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88734281 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (3-acetylsulfanyl-4-oxo-2,4-diphenylbutanoyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC(C(=O)c1ccccc1)C(C(=O)OC(=O)[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO5S/c1-15(25)30-21(20(26)17-11-6-3-7-12-17)19(16-9-4-2-5-10-16)23(28)29-22(27)18-13-8-14-24-18/h2-7,9-12,18-19,21,24H,8,13-14H2,1H3/t18-,19?,21?/m0/s1 |
| InChIKey | IALLJBPCYRZACE-JSOIOWGOSA-N |
| XLogP | 3.12 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|