C17H23N3O4 — CID 88683377
[(3-amino-2-oxo-4-phenylbutyl)-methylcarbamoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88683377) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is [(3-amino-2-oxo-4-phenylbutyl)-methylcarbamoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(3-amino-2-oxo-4-phenylbutyl)-methylcarbamoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88683377 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [(3-amino-2-oxo-4-phenylbutyl)-methylcarbamoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CN(CC(=O)C(N)Cc1ccccc1)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H23N3O4/c1-20(17(23)24-16(22)14-8-5-9-19-14)11-15(21)13(18)10-12-6-3-2-4-7-12/h2-4,6-7,13-14,19H,5,8-11,18H2,1H3/t13?,14-/m0/s1 |
| InChIKey | SUKKFMWUAWGTMK-KZUDCZAMSA-N |
| XLogP | 0.47 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|