C16H23N2O5P — CID 88698151
(1-amino-3-phenylpropyl)-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid (PubChem CID 88698151) has the molecular formula C16H23N2O5P and a molecular weight of 354.34 g/mol. Its IUPAC name is (1-amino-3-phenylpropyl)-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid.
| Compound Name | (1-amino-3-phenylpropyl)-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid |
|---|---|
| PubChem CID | 88698151 |
| Molecular Formula | C16H23N2O5P |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (1-amino-3-phenylpropyl)-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid |
| SMILES | NC(CCc1ccccc1)P(=O)(O)CC(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H23N2O5P/c17-14(9-8-12-5-2-1-3-6-12)24(21,22)11-15(19)23-16(20)13-7-4-10-18-13/h1-3,5-6,13-14,18H,4,7-11,17H2,(H,21,22)/t13-,14?/m0/s1 |
| InChIKey | ZACDGFVMWXEQBS-LSLKUGRBSA-N |
| XLogP | 1.00 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|