C14H18NO5P — CID 88790917
benzyl-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid (PubChem CID 88790917) has the molecular formula C14H18NO5P and a molecular weight of 311.27 g/mol. Its IUPAC name is benzyl-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid.
| Compound Name | benzyl-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid |
|---|---|
| PubChem CID | 88790917 |
| Molecular Formula | C14H18NO5P |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | benzyl-[2-oxo-2-[(2S)-pyrrolidine-2-carbonyl]oxyethyl]phosphinic acid |
| SMILES | O=C(CP(=O)(O)Cc1ccccc1)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H18NO5P/c16-13(20-14(17)12-7-4-8-15-12)10-21(18,19)9-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | VTNGOLVUNFVGIZ-LBPRGKRZSA-N |
| XLogP | 1.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|