C18H22FNO4S — CID 88733649
[3-acetylsulfanyl-4-(3-fluorophenyl)-2-methylbutanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88733649) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is [3-acetylsulfanyl-4-(3-fluorophenyl)-2-methylbutanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [3-acetylsulfanyl-4-(3-fluorophenyl)-2-methylbutanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88733649 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [3-acetylsulfanyl-4-(3-fluorophenyl)-2-methylbutanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC(Cc1cccc(F)c1)C(C)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H22FNO4S/c1-11(17(22)24-18(23)15-7-4-8-20-15)16(25-12(2)21)10-13-5-3-6-14(19)9-13/h3,5-6,9,11,15-16,20H,4,7-8,10H2,1-2H3/t11?,15-,16?/m0/s1 |
| InChIKey | IZINGMHFXIHKMP-AJQRCPHMSA-N |
| XLogP | 2.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|