C17H25FN2O — CID 106626682
2-(3-fluorophenyl)-N-(piperidin-2-ylmethyl)-N-propan-2-ylacetamide (PubChem CID 106626682) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(piperidin-2-ylmethyl)-N-propan-2-ylacetamide.
| Compound Name | 2-(3-fluorophenyl)-N-(piperidin-2-ylmethyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 106626682 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(piperidin-2-ylmethyl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(CC1CCCCN1)C(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H25FN2O/c1-13(2)20(12-16-8-3-4-9-19-16)17(21)11-14-6-5-7-15(18)10-14/h5-7,10,13,16,19H,3-4,8-9,11-12H2,1-2H3 |
| InChIKey | SSQRVLWWAGLGME-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |