C20H24F2N2 — CID 95731958
N,N-bis[(3-fluorophenyl)methyl]-1-[(2R)-piperidin-2-yl]methanamine (PubChem CID 95731958) has the molecular formula C20H24F2N2 and a molecular weight of 330.42 g/mol. Its IUPAC name is N,N-bis[(3-fluorophenyl)methyl]-1-[(2R)-piperidin-2-yl]methanamine.
| Compound Name | N,N-bis[(3-fluorophenyl)methyl]-1-[(2R)-piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 95731958 |
| Molecular Formula | C20H24F2N2 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N,N-bis[(3-fluorophenyl)methyl]-1-[(2R)-piperidin-2-yl]methanamine |
| SMILES | Fc1cccc(CN(Cc2cccc(F)c2)C[C@H]2CCCCN2)c1 |
| InChI | InChI=1S/C20H24F2N2/c21-18-7-3-5-16(11-18)13-24(15-20-9-1-2-10-23-20)14-17-6-4-8-19(22)12-17/h3-8,11-12,20,23H,1-2,9-10,13-15H2/t20-/m1/s1 |
| InChIKey | SCODIQXEPJBJLM-HXUWFJFHSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |