C17H18BrNO5S — CID 88782883
[3-acetylsulfanyl-4-(4-bromophenyl)-4-oxobutanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88782883) has the molecular formula C17H18BrNO5S and a molecular weight of 428.30 g/mol. Its IUPAC name is [3-acetylsulfanyl-4-(4-bromophenyl)-4-oxobutanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [3-acetylsulfanyl-4-(4-bromophenyl)-4-oxobutanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88782883 |
| Molecular Formula | C17H18BrNO5S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | [3-acetylsulfanyl-4-(4-bromophenyl)-4-oxobutanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC(CC(=O)OC(=O)[C@@H]1CCCN1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO5S/c1-10(20)25-14(16(22)11-4-6-12(18)7-5-11)9-15(21)24-17(23)13-3-2-8-19-13/h4-7,13-14,19H,2-3,8-9H2,1H3/t13-,14?/m0/s1 |
| InChIKey | WVBQNMAEVBZKHM-LSLKUGRBSA-N |
| XLogP | 2.49 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|