C22H23NO5S — CID 88734316
(3-acetylsulfanyl-2-methyl-4-naphthalen-1-yl-4-oxobutanoyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 88734316) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (3-acetylsulfanyl-2-methyl-4-naphthalen-1-yl-4-oxobutanoyl) (2S)-pyrrolidine-2-carboxylate.
| Compound Name | (3-acetylsulfanyl-2-methyl-4-naphthalen-1-yl-4-oxobutanoyl) (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88734316 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3-acetylsulfanyl-2-methyl-4-naphthalen-1-yl-4-oxobutanoyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC(C(=O)c1cccc2ccccc12)C(C)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C22H23NO5S/c1-13(21(26)28-22(27)18-11-6-12-23-18)20(29-14(2)24)19(25)17-10-5-8-15-7-3-4-9-16(15)17/h3-5,7-10,13,18,20,23H,6,11-12H2,1-2H3/t13?,18-,20?/m0/s1 |
| InChIKey | JTCSTCRHKUSMFY-IXOJTGDKSA-N |
| XLogP | 3.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|