About propanethioyl (2S)-pyrrolidine-2-carboxylate
propanethioyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 88795719) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is propanethioyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | propanethioyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 88795719 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | propanethioyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | CCC(=S)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H13NO2S/c1-2-7(12)11-8(10)6-4-3-5-9-6/h6,9H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | CNBXPPCZFQSCCO-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propanethioyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanethioyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of propanethioyl (2S)-pyrrolidine-2-carboxylate (CID 88795719) is propanethioyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for propanethioyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for propanethioyl (2S)-pyrrolidine-2-carboxylate is CCC(=S)OC(=O)[C@@H]1CCCN1.
What is the InChIKey of propanethioyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is CNBXPPCZFQSCCO-LURJTMIESA-N. The full InChI is InChI=1S/C8H13NO2S/c1-2-7(12)11-8(10)6-4-3-5-9-6/h6,9H,2-5H2,1H3/t6-/m0/s1.
What are the key properties of propanethioyl (2S)-pyrrolidine-2-carboxylate?
propanethioyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 187.26 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanethioyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 88795719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).