About tetradecanoyl (2R)-pyrrolidine-2-carboxylate
tetradecanoyl (2R)-pyrrolidine-2-carboxylate (PubChem CID 90102805) has the molecular formula C19H35NO3
and a molecular weight of 325.49 g/mol. Its IUPAC name is tetradecanoyl (2R)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | tetradecanoyl (2R)-pyrrolidine-2-carboxylate |
| PubChem CID | 90102805 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tetradecanoyl (2R)-pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCCCCCC(=O)OC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C19H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(21)23-19(22)17-14-13-16-20-17/h17,20H,2-16H2,1H3/t17-/m1/s1 |
| InChIKey | LFZJRZWBWSDQCX-QGZVFWFLSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tetradecanoyl (2R)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecanoyl (2R)-pyrrolidine-2-carboxylate?
The IUPAC name of tetradecanoyl (2R)-pyrrolidine-2-carboxylate (CID 90102805) is tetradecanoyl (2R)-pyrrolidine-2-carboxylate.
What is the SMILES notation for tetradecanoyl (2R)-pyrrolidine-2-carboxylate?
The canonical SMILES for tetradecanoyl (2R)-pyrrolidine-2-carboxylate is CCCCCCCCCCCCCC(=O)OC(=O)[C@H]1CCCN1.
What is the InChIKey of tetradecanoyl (2R)-pyrrolidine-2-carboxylate?
The InChIKey is LFZJRZWBWSDQCX-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(21)23-19(22)17-14-13-16-20-17/h17,20H,2-16H2,1H3/t17-/m1/s1.
What are the key properties of tetradecanoyl (2R)-pyrrolidine-2-carboxylate?
tetradecanoyl (2R)-pyrrolidine-2-carboxylate has a molecular weight of 325.49 g/mol, XLogP of 4.51, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecanoyl (2R)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 90102805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).