About dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate
dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate (PubChem CID 90778333) has the molecular formula C17H29NO4
and a molecular weight of 311.42 g/mol. Its IUPAC name is dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate |
| PubChem CID | 90778333 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCCCC(=O)OC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C17H29NO4/c1-2-3-4-5-6-7-8-9-10-11-16(20)22-17(21)14-12-13-15(19)18-14/h14H,2-13H2,1H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | ADQOVPXMLTUGKX-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate?
The IUPAC name of dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate (CID 90778333) is dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate is CCCCCCCCCCCC(=O)OC(=O)[C@@H]1CCC(=O)N1.
What is the InChIKey of dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate?
The InChIKey is ADQOVPXMLTUGKX-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H29NO4/c1-2-3-4-5-6-7-8-9-10-11-16(20)22-17(21)14-12-13-15(19)18-14/h14H,2-13H2,1H3,(H,18,19)/t14-/m0/s1.
What are the key properties of dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate?
dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate has a molecular weight of 311.42 g/mol, XLogP of 3.26, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoyl (2S)-5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 90778333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).