About 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate
3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 88771059) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 88771059 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | CCC(S)CC(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H17NO3S/c1-2-7(15)6-9(12)14-10(13)8-4-3-5-11-8/h7-8,11,15H,2-6H2,1H3/t7?,8-/m0/s1 |
| InChIKey | NZGPGDITHFTYNK-MQWKRIRWSA-N |
| XLogP | 0.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate (CID 88771059) is 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate is CCC(S)CC(=O)OC(=O)[C@@H]1CCCN1.
What is the InChIKey of 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is NZGPGDITHFTYNK-MQWKRIRWSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-2-7(15)6-9(12)14-10(13)8-4-3-5-11-8/h7-8,11,15H,2-6H2,1H3/t7?,8-/m0/s1.
What are the key properties of 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate?
3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 231.32 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpentanoyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 88771059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).